About ethane;(1Z,2Z)-1-ethylidene-3-methyl-2-prop-2-enylidenecyclohexane
ethane;(1Z,2Z)-1-ethylidene-3-methyl-2-prop-2-enylidenecyclohexane (PubChem CID 157035804) has the molecular formula C16H30
and a molecular weight of 222.42 g/mol. Its IUPAC name is ethane;(1Z,2Z)-1-ethylidene-3-methyl-2-prop-2-enylidenecyclohexane.
Molecular Properties
| Compound Name | ethane;(1Z,2Z)-1-ethylidene-3-methyl-2-prop-2-enylidenecyclohexane |
| PubChem CID | 157035804 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | ethane;(1Z,2Z)-1-ethylidene-3-methyl-2-prop-2-enylidenecyclohexane |
| SMILES | C=C/C=C1C(=C/C)\CCCC\1C.CC.CC |
| InChI | InChI=1S/C12H18.2C2H6/c1-4-7-12-10(3)8-6-9-11(12)5-2;2*1-2/h4-5,7,10H,1,6,8-9H2,2-3H3;2*1-2H3/b11-5-,12-7-;; |
| InChIKey | HQBGDOYJTJPQRD-QIPFNBHCSA-N |
| XLogP | 5.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;(1Z,2Z)-1-ethylidene-3-methyl-2-prop-2-enylidenecyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(1Z,2Z)-1-ethylidene-3-methyl-2-prop-2-enylidenecyclohexane?
The IUPAC name of ethane;(1Z,2Z)-1-ethylidene-3-methyl-2-prop-2-enylidenecyclohexane (CID 157035804) is ethane;(1Z,2Z)-1-ethylidene-3-methyl-2-prop-2-enylidenecyclohexane.
What is the SMILES notation for ethane;(1Z,2Z)-1-ethylidene-3-methyl-2-prop-2-enylidenecyclohexane?
The canonical SMILES for ethane;(1Z,2Z)-1-ethylidene-3-methyl-2-prop-2-enylidenecyclohexane is C=C/C=C1C(=C/C)\CCCC\1C.CC.CC.
What is the InChIKey of ethane;(1Z,2Z)-1-ethylidene-3-methyl-2-prop-2-enylidenecyclohexane?
The InChIKey is HQBGDOYJTJPQRD-QIPFNBHCSA-N. The full InChI is InChI=1S/C12H18.2C2H6/c1-4-7-12-10(3)8-6-9-11(12)5-2;2*1-2/h4-5,7,10H,1,6,8-9H2,2-3H3;2*1-2H3/b11-5-,12-7-;;.
What are the key properties of ethane;(1Z,2Z)-1-ethylidene-3-methyl-2-prop-2-enylidenecyclohexane?
ethane;(1Z,2Z)-1-ethylidene-3-methyl-2-prop-2-enylidenecyclohexane has a molecular weight of 222.42 g/mol, XLogP of 5.92, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(1Z,2Z)-1-ethylidene-3-methyl-2-prop-2-enylidenecyclohexane is sourced from PubChem (CID 157035804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).