C13H18NO4S- — CID 146174944
(2E,3Z,5R)-5-(2-carboxyethyl)-2-ethylidene-3-prop-2-enylidenepiperidine-1-sulfinate (PubChem CID 146174944) has the molecular formula C13H18NO4S- and a molecular weight of 284.36 g/mol. Its IUPAC name is (2E,3Z,5R)-5-(2-carboxyethyl)-2-ethylidene-3-prop-2-enylidenepiperidine-1-sulfinate.
| Compound Name | (2E,3Z,5R)-5-(2-carboxyethyl)-2-ethylidene-3-prop-2-enylidenepiperidine-1-sulfinate |
|---|---|
| PubChem CID | 146174944 |
| Molecular Formula | C13H18NO4S- |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (2E,3Z,5R)-5-(2-carboxyethyl)-2-ethylidene-3-prop-2-enylidenepiperidine-1-sulfinate |
| SMILES | C=C/C=C1/C[C@@H](CCC(=O)O)CN(S(=O)[O-])/C1=C/C |
| InChI | InChI=1S/C13H19NO4S/c1-3-5-11-8-10(6-7-13(15)16)9-14(19(17)18)12(11)4-2/h3-5,10H,1,6-9H2,2H3,(H,15,16)(H,17,18)/p-1/b11-5-,12-4+/t10-/m1/s1 |
| InChIKey | LANOUJLZISJQCW-ZDYWMTKJSA-M |
| XLogP | 1.98 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|