C19H28N2O5S — CID 146174779
1-[3-[(3R,5Z,6E)-6-ethylidene-5-prop-2-enylidene-1-sulfinopiperidin-3-yl]propanoyl]piperidine-4-carboxylic acid (PubChem CID 146174779) has the molecular formula C19H28N2O5S and a molecular weight of 396.51 g/mol. Its IUPAC name is 1-[3-[(3R,5Z,6E)-6-ethylidene-5-prop-2-enylidene-1-sulfinopiperidin-3-yl]propanoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[3-[(3R,5Z,6E)-6-ethylidene-5-prop-2-enylidene-1-sulfinopiperidin-3-yl]propanoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 146174779 |
| Molecular Formula | C19H28N2O5S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 1-[3-[(3R,5Z,6E)-6-ethylidene-5-prop-2-enylidene-1-sulfinopiperidin-3-yl]propanoyl]piperidine-4-carboxylic acid |
| SMILES | C=C/C=C1/C[C@@H](CCC(=O)N2CCC(C(=O)O)CC2)CN(S(=O)O)/C1=C/C |
| InChI | InChI=1S/C19H28N2O5S/c1-3-5-16-12-14(13-21(27(25)26)17(16)4-2)6-7-18(22)20-10-8-15(9-11-20)19(23)24/h3-5,14-15H,1,6-13H2,2H3,(H,23,24)(H,25,26)/b16-5-,17-4+/t14-/m1/s1 |
| InChIKey | RXLZTKRWDAFOAP-UOGIVTFTSA-N |
| XLogP | 2.56 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|