C17H25N2O5S- — CID 134266483
(3R,5E,6E)-5-ethylidene-3-methyl-2-(3-morpholin-4-yl-3-oxopropyl)-6-prop-2-enylidenemorpholine-4-sulfinate (PubChem CID 134266483) has the molecular formula C17H25N2O5S- and a molecular weight of 369.46 g/mol. Its IUPAC name is (3R,5E,6E)-5-ethylidene-3-methyl-2-(3-morpholin-4-yl-3-oxopropyl)-6-prop-2-enylidenemorpholine-4-sulfinate.
| Compound Name | (3R,5E,6E)-5-ethylidene-3-methyl-2-(3-morpholin-4-yl-3-oxopropyl)-6-prop-2-enylidenemorpholine-4-sulfinate |
|---|---|
| PubChem CID | 134266483 |
| Molecular Formula | C17H25N2O5S- |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (3R,5E,6E)-5-ethylidene-3-methyl-2-(3-morpholin-4-yl-3-oxopropyl)-6-prop-2-enylidenemorpholine-4-sulfinate |
| SMILES | C=C/C=C1/OC(CCC(=O)N2CCOCC2)[C@@H](C)N(S(=O)[O-])/C1=C/C |
| InChI | InChI=1S/C17H26N2O5S/c1-4-6-16-14(5-2)19(25(21)22)13(3)15(24-16)7-8-17(20)18-9-11-23-12-10-18/h4-6,13,15H,1,7-12H2,2-3H3,(H,21,22)/p-1/b14-5+,16-6+/t13-,15?/m1/s1 |
| InChIKey | NIRSSFRTBPSPPV-OCJKUQJHSA-M |
| XLogP | 1.48 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|