C9H13NO — CID 170059513
(3E,4E)-3-ethylidene-4-propylidenepyrrolidin-2-one (PubChem CID 170059513) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is (3E,4E)-3-ethylidene-4-propylidenepyrrolidin-2-one.
| Compound Name | (3E,4E)-3-ethylidene-4-propylidenepyrrolidin-2-one |
|---|---|
| PubChem CID | 170059513 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (3E,4E)-3-ethylidene-4-propylidenepyrrolidin-2-one |
| SMILES | C/C=C1/C(=O)NC/C1=C/CC |
| InChI | InChI=1S/C9H13NO/c1-3-5-7-6-10-9(11)8(7)4-2/h4-5H,3,6H2,1-2H3,(H,10,11)/b7-5-,8-4+ |
| InChIKey | RBANQQRYYNKWKX-DZAKWUEVSA-N |
| XLogP | 1.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|