C17H27N3O — CID 167446867
(E)-3-amino-N-[(3Z,5Z,7Z)-6-ethyl-3-methylnona-3,5,7-trien-4-yl]-2-(methyliminomethyl)prop-2-enamide (PubChem CID 167446867) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is (E)-3-amino-N-[(3Z,5Z,7Z)-6-ethyl-3-methylnona-3,5,7-trien-4-yl]-2-(methyliminomethyl)prop-2-enamide.
| Compound Name | (E)-3-amino-N-[(3Z,5Z,7Z)-6-ethyl-3-methylnona-3,5,7-trien-4-yl]-2-(methyliminomethyl)prop-2-enamide |
|---|---|
| PubChem CID | 167446867 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | (E)-3-amino-N-[(3Z,5Z,7Z)-6-ethyl-3-methylnona-3,5,7-trien-4-yl]-2-(methyliminomethyl)prop-2-enamide |
| SMILES | C/C=C\C(=C/C(NC(=O)C(/C=N/C)=C/N)=C(\C)CC)CC |
| InChI | InChI=1S/C17H27N3O/c1-6-9-14(8-3)10-16(13(4)7-2)20-17(21)15(11-18)12-19-5/h6,9-12H,7-8,18H2,1-5H3,(H,20,21)/b9-6-,14-10-,15-11+,16-13-,19-12+ |
| InChIKey | JAFAAHVQDVVXRT-VRSJRJAQSA-N |
| XLogP | 3.24 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|