C17H23F3N2O — CID 123293767
4-ethylimino-3-fluoro-2-(fluoromethyl)-N-(5-fluoro-2-methyl-6-methylideneocta-2,4-dien-3-yl)but-2-enamide (PubChem CID 123293767) has the molecular formula C17H23F3N2O and a molecular weight of 328.38 g/mol. Its IUPAC name is 4-ethylimino-3-fluoro-2-(fluoromethyl)-N-(5-fluoro-2-methyl-6-methylideneocta-2,4-dien-3-yl)but-2-enamide.
| Compound Name | 4-ethylimino-3-fluoro-2-(fluoromethyl)-N-(5-fluoro-2-methyl-6-methylideneocta-2,4-dien-3-yl)but-2-enamide |
|---|---|
| PubChem CID | 123293767 |
| Molecular Formula | C17H23F3N2O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 4-ethylimino-3-fluoro-2-(fluoromethyl)-N-(5-fluoro-2-methyl-6-methylideneocta-2,4-dien-3-yl)but-2-enamide |
| SMILES | C=C(CC)C(F)=CC(NC(=O)C(CF)=C(F)/C=N/CC)=C(C)C |
| InChI | InChI=1S/C17H23F3N2O/c1-6-12(5)14(19)8-16(11(3)4)22-17(23)13(9-18)15(20)10-21-7-2/h8,10H,5-7,9H2,1-4H3,(H,22,23)/b14-8?,15-13?,21-10+ |
| InChIKey | HCNCNOBCKFFXQO-NXUQADERSA-N |
| XLogP | 4.50 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|