C12H15N2ORe- — CID 171513057
5-methyl-N-[(E)-pent-2-en-2-yl]-2H-pyridin-2-ide-4-carboxamide;rhenium (PubChem CID 171513057) has the molecular formula C12H15N2ORe- and a molecular weight of 389.47 g/mol. Its IUPAC name is 5-methyl-N-[(E)-pent-2-en-2-yl]-2H-pyridin-2-ide-4-carboxamide;rhenium.
| Compound Name | 5-methyl-N-[(E)-pent-2-en-2-yl]-2H-pyridin-2-ide-4-carboxamide;rhenium |
|---|---|
| PubChem CID | 171513057 |
| Molecular Formula | C12H15N2ORe- |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 5-methyl-N-[(E)-pent-2-en-2-yl]-2H-pyridin-2-ide-4-carboxamide;rhenium |
| SMILES | CC/C=C(\C)NC(=O)c1c[c-]ncc1C.[Re] |
| InChI | InChI=1S/C12H15N2O.Re/c1-4-5-10(3)14-12(15)11-6-7-13-8-9(11)2;/h5-6,8H,4H2,1-3H3,(H,14,15);/q-1;/b10-5+; |
| InChIKey | ARQXWYFUQSDBIC-OAZHBLANSA-N |
| XLogP | 2.23 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|