C17H26N2O3 — CID 123567531
(6S,7S)-7-(3-aminopropylamino)-6-methoxy-8,8-dimethyl-6,7-dihydro-5H-naphthalene-2-carboxylic acid (PubChem CID 123567531) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is (6S,7S)-7-(3-aminopropylamino)-6-methoxy-8,8-dimethyl-6,7-dihydro-5H-naphthalene-2-carboxylic acid.
| Compound Name | (6S,7S)-7-(3-aminopropylamino)-6-methoxy-8,8-dimethyl-6,7-dihydro-5H-naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 123567531 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (6S,7S)-7-(3-aminopropylamino)-6-methoxy-8,8-dimethyl-6,7-dihydro-5H-naphthalene-2-carboxylic acid |
| SMILES | CO[C@H]1Cc2ccc(C(=O)O)cc2C(C)(C)C1NCCCN |
| InChI | InChI=1S/C17H26N2O3/c1-17(2)13-9-12(16(20)21)6-5-11(13)10-14(22-3)15(17)19-8-4-7-18/h5-6,9,14-15,19H,4,7-8,10,18H2,1-3H3,(H,20,21)/t14-,15?/m0/s1 |
| InChIKey | NPIHBGPSCVRPIF-MLCCFXAWSA-N |
| XLogP | 1.54 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|