C27H31NO3 — CID 139053887
[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylazanium;tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene-5-carboxylate (PubChem CID 139053887) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is [(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylazanium;tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene-5-carboxylate.
| Compound Name | [(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylazanium;tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 139053887 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | [(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]-methylazanium;tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene-5-carboxylate |
| SMILES | C[NH2+][C@@H](C)[C@H](O)c1ccccc1.O=C([O-])c1cc2ccc1CCc1ccc(cc1)CC2 |
| InChI | InChI=1S/C17H16O2.C10H15NO/c18-17(19)16-11-14-6-5-12-1-3-13(4-2-12)7-9-15(16)10-8-14;1-8(11-2)10(12)9-6-4-3-5-7-9/h1-4,8,10-11H,5-7,9H2,(H,18,19);3-8,10-12H,1-2H3/t;8-,10-/m.0/s1 |
| InChIKey | BGIFATXJGCOHPD-CGUPRBNSSA-N |
| XLogP | 2.24 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |