C12H11BO3 — CID 123567559
8,9-dihydrodibenzofuran-4-ylboronic acid (PubChem CID 123567559) has the molecular formula C12H11BO3 and a molecular weight of 214.03 g/mol. Its IUPAC name is 8,9-dihydrodibenzofuran-4-ylboronic acid.
| Compound Name | 8,9-dihydrodibenzofuran-4-ylboronic acid |
|---|---|
| PubChem CID | 123567559 |
| Molecular Formula | C12H11BO3 |
| Molecular Weight | 214.03 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 8,9-dihydrodibenzofuran-4-ylboronic acid |
| SMILES | OB(O)c1cccc2c3c(oc12)C=CCC3 |
| InChI | InChI=1S/C12H11BO3/c14-13(15)10-6-3-5-9-8-4-1-2-7-11(8)16-12(9)10/h2-3,5-7,14-15H,1,4H2 |
| InChIKey | KMFHPXPEIDFBEB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.03 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|