8,9-dihydrodibenzofuran-4-ylboronic acid

C12H11BO3 — CID 123567559

IUPAC8,9-dihydrodibenzofuran-4-ylboronic acid
SMILESOB(O)c1cccc2c3c(oc12)C=CCC3
InChIInChI=1S/C12H11BO3/c14-13(15)10-6-3-5-9-8-4-1-2-7-11(8)16-12(9)10/h2-3,5-7,14-15H,1,4H2
InChIKeyKMFHPXPEIDFBEB-UHFFFAOYSA-N
MW214.03 g/mol
LogP1.07
Rot. Bonds1

About 8,9-dihydrodibenzofuran-4-ylboronic acid

8,9-dihydrodibenzofuran-4-ylboronic acid (PubChem CID 123567559) has the molecular formula C12H11BO3 and a molecular weight of 214.03 g/mol. Its IUPAC name is 8,9-dihydrodibenzofuran-4-ylboronic acid.

Molecular Properties

Compound Name8,9-dihydrodibenzofuran-4-ylboronic acid
PubChem CID123567559
Molecular FormulaC12H11BO3
Molecular Weight214.03 g/mol
Exact Mass214.08
IUPAC Name8,9-dihydrodibenzofuran-4-ylboronic acid
SMILESOB(O)c1cccc2c3c(oc12)C=CCC3
InChIInChI=1S/C12H11BO3/c14-13(15)10-6-3-5-9-8-4-1-2-7-11(8)16-12(9)10/h2-3,5-7,14-15H,1,4H2
InChIKeyKMFHPXPEIDFBEB-UHFFFAOYSA-N
XLogP1.07
TPSA53.60 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.03
LogP ≤ 51.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze 8,9-dihydrodibenzofuran-4-ylboronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8,9-dihydrodibenzofuran-4-ylboronic acid?
The IUPAC name of 8,9-dihydrodibenzofuran-4-ylboronic acid (CID 123567559) is 8,9-dihydrodibenzofuran-4-ylboronic acid.
What is the SMILES notation for 8,9-dihydrodibenzofuran-4-ylboronic acid?
The canonical SMILES for 8,9-dihydrodibenzofuran-4-ylboronic acid is OB(O)c1cccc2c3c(oc12)C=CCC3.
What is the InChIKey of 8,9-dihydrodibenzofuran-4-ylboronic acid?
The InChIKey is KMFHPXPEIDFBEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BO3/c14-13(15)10-6-3-5-9-8-4-1-2-7-11(8)16-12(9)10/h2-3,5-7,14-15H,1,4H2.
What are the key properties of 8,9-dihydrodibenzofuran-4-ylboronic acid?
8,9-dihydrodibenzofuran-4-ylboronic acid has a molecular weight of 214.03 g/mol, XLogP of 1.07, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-dihydrodibenzofuran-4-ylboronic acid is sourced from PubChem (CID 123567559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).