C20H21NO — CID 145105452
ethane;N-phenyl-8,9-dihydrodibenzofuran-4-amine (PubChem CID 145105452) has the molecular formula C20H21NO and a molecular weight of 291.39 g/mol. Its IUPAC name is ethane;N-phenyl-8,9-dihydrodibenzofuran-4-amine.
| Compound Name | ethane;N-phenyl-8,9-dihydrodibenzofuran-4-amine |
|---|---|
| PubChem CID | 145105452 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | ethane;N-phenyl-8,9-dihydrodibenzofuran-4-amine |
| SMILES | C1=Cc2oc3c(Nc4ccccc4)cccc3c2CC1.CC |
| InChI | InChI=1S/C18H15NO.C2H6/c1-2-7-13(8-3-1)19-16-11-6-10-15-14-9-4-5-12-17(14)20-18(15)16;1-2/h1-3,5-8,10-12,19H,4,9H2;1-2H3 |
| InChIKey | YWBVSLAGXSPRJF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |