C18H15NO — CID 174387445
N-phenyl-1,2-dihydrodibenzofuran-3-amine (PubChem CID 174387445) has the molecular formula C18H15NO and a molecular weight of 261.32 g/mol. Its IUPAC name is N-phenyl-1,2-dihydrodibenzofuran-3-amine.
| Compound Name | N-phenyl-1,2-dihydrodibenzofuran-3-amine |
|---|---|
| PubChem CID | 174387445 |
| Molecular Formula | C18H15NO |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | N-phenyl-1,2-dihydrodibenzofuran-3-amine |
| SMILES | C1=C(Nc2ccccc2)CCc2c1oc1ccccc21 |
| InChI | InChI=1S/C18H15NO/c1-2-6-13(7-3-1)19-14-10-11-16-15-8-4-5-9-17(15)20-18(16)12-14/h1-9,12,19H,10-11H2 |
| InChIKey | CZARVFARVMXEDY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |