About 2-anilinochromen-4-one
2-anilinochromen-4-one (PubChem CID 10823780) has the molecular formula C15H11NO2
and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-anilinochromen-4-one.
Molecular Properties
| Compound Name | 2-anilinochromen-4-one |
| PubChem CID | 10823780 |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 2-anilinochromen-4-one |
| SMILES | O=c1cc(Nc2ccccc2)oc2ccccc12 |
| InChI | InChI=1S/C15H11NO2/c17-13-10-15(16-11-6-2-1-3-7-11)18-14-9-5-4-8-12(13)14/h1-10,16H |
| InChIKey | PQZJFMHGGDECSB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-anilinochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilinochromen-4-one?
The IUPAC name of 2-anilinochromen-4-one (CID 10823780) is 2-anilinochromen-4-one.
What is the SMILES notation for 2-anilinochromen-4-one?
The canonical SMILES for 2-anilinochromen-4-one is O=c1cc(Nc2ccccc2)oc2ccccc12.
What is the InChIKey of 2-anilinochromen-4-one?
The InChIKey is PQZJFMHGGDECSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO2/c17-13-10-15(16-11-6-2-1-3-7-11)18-14-9-5-4-8-12(13)14/h1-10,16H.
What are the key properties of 2-anilinochromen-4-one?
2-anilinochromen-4-one has a molecular weight of 237.26 g/mol, XLogP of 3.54, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilinochromen-4-one is sourced from PubChem (CID 10823780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).