C20H39NO2 — CID 123568352
2-amino-2-(3-ethyl-6-methyltetradeca-3,5-dienyl)propane-1,3-diol (PubChem CID 123568352) has the molecular formula C20H39NO2 and a molecular weight of 325.54 g/mol. Its IUPAC name is 2-amino-2-(3-ethyl-6-methyltetradeca-3,5-dienyl)propane-1,3-diol.
| Compound Name | 2-amino-2-(3-ethyl-6-methyltetradeca-3,5-dienyl)propane-1,3-diol |
|---|---|
| PubChem CID | 123568352 |
| Molecular Formula | C20H39NO2 |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.30 |
| IUPAC Name | 2-amino-2-(3-ethyl-6-methyltetradeca-3,5-dienyl)propane-1,3-diol |
| SMILES | CCCCCCCCC(C)=CC=C(CC)CCC(N)(CO)CO |
| InChI | InChI=1S/C20H39NO2/c1-4-6-7-8-9-10-11-18(3)12-13-19(5-2)14-15-20(21,16-22)17-23/h12-13,22-23H,4-11,14-17,21H2,1-3H3 |
| InChIKey | QVUKMITZPZTEMQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|