C31H41N6O8+ — CID 123568493
[5-acetamido-2-(3-ethylimino-2-hydrazinylidenepropoxy)-4-hydroxy-6-[3-hydroxy-4-[(4-phenylbenzoyl)amino]butan-2-yl]oxane-2-carbonyl]-methyl-oxoazanium (PubChem CID 123568493) has the molecular formula C31H41N6O8+ and a molecular weight of 625.70 g/mol. Its IUPAC name is [5-acetamido-2-(3-ethylimino-2-hydrazinylidenepropoxy)-4-hydroxy-6-[3-hydroxy-4-[(4-phenylbenzoyl)amino]butan-2-yl]oxane-2-carbonyl]-methyl-oxoazanium.
| Compound Name | [5-acetamido-2-(3-ethylimino-2-hydrazinylidenepropoxy)-4-hydroxy-6-[3-hydroxy-4-[(4-phenylbenzoyl)amino]butan-2-yl]oxane-2-carbonyl]-methyl-oxoazanium |
|---|---|
| PubChem CID | 123568493 |
| Molecular Formula | C31H41N6O8+ |
| Molecular Weight | 625.70 g/mol |
| Exact Mass | 625.30 |
| IUPAC Name | [5-acetamido-2-(3-ethylimino-2-hydrazinylidenepropoxy)-4-hydroxy-6-[3-hydroxy-4-[(4-phenylbenzoyl)amino]butan-2-yl]oxane-2-carbonyl]-methyl-oxoazanium |
| SMILES | CC/N=C/C(COC1(C(=O)[N+](C)=O)CC(O)C(NC(C)=O)C(C(C)C(O)CNC(=O)c2ccc(-c3ccccc3)cc2)O1)=NN |
| InChI | InChI=1S/C31H40N6O8/c1-5-33-16-24(36-32)18-44-31(30(42)37(4)43)15-25(39)27(35-20(3)38)28(45-31)19(2)26(40)17-34-29(41)23-13-11-22(12-14-23)21-9-7-6-8-10-21/h6-14,16,19,25-28,39-40H,5,15,17-18H2,1-4H3,(H3-,32,33,34,35,38,41)/p+1 |
| InChIKey | GMJWIKMBMHXHFF-UHFFFAOYSA-O |
| XLogP | 0.79 |
| TPSA | 205.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.70 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|