C29H37N3O8 — CID 123599199
methyl 5-acetamido-2-butoxy-4-hydroxy-6-[2-nitroso-3-[(4-phenylbenzoyl)amino]propyl]oxane-2-carboxylate (PubChem CID 123599199) has the molecular formula C29H37N3O8 and a molecular weight of 555.63 g/mol. Its IUPAC name is methyl 5-acetamido-2-butoxy-4-hydroxy-6-[2-nitroso-3-[(4-phenylbenzoyl)amino]propyl]oxane-2-carboxylate.
| Compound Name | methyl 5-acetamido-2-butoxy-4-hydroxy-6-[2-nitroso-3-[(4-phenylbenzoyl)amino]propyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 123599199 |
| Molecular Formula | C29H37N3O8 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | methyl 5-acetamido-2-butoxy-4-hydroxy-6-[2-nitroso-3-[(4-phenylbenzoyl)amino]propyl]oxane-2-carboxylate |
| SMILES | CCCCOC1(C(=O)OC)CC(O)C(NC(C)=O)C(CC(CNC(=O)c2ccc(-c3ccccc3)cc2)N=O)O1 |
| InChI | InChI=1S/C29H37N3O8/c1-4-5-15-39-29(28(36)38-3)17-24(34)26(31-19(2)33)25(40-29)16-23(32-37)18-30-27(35)22-13-11-21(12-14-22)20-9-7-6-8-10-20/h6-14,23-26,34H,4-5,15-18H2,1-3H3,(H,30,35)(H,31,33) |
| InChIKey | FTARPILRLJQODS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 152.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|