C40H53N3O13 — CID 146245144
methyl (2R,4S,5R)-5-acetamido-6-[(1R,2R)-1,2-diacetyloxy-3-[(4-phenylbenzoyl)amino]propyl]-2-(6-ethoxy-6-oxohexoxy)-4-(propanoylamino)oxane-2-carboxylate (PubChem CID 146245144) has the molecular formula C40H53N3O13 and a molecular weight of 783.87 g/mol. Its IUPAC name is methyl (2R,4S,5R)-5-acetamido-6-[(1R,2R)-1,2-diacetyloxy-3-[(4-phenylbenzoyl)amino]propyl]-2-(6-ethoxy-6-oxohexoxy)-4-(propanoylamino)oxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R)-5-acetamido-6-[(1R,2R)-1,2-diacetyloxy-3-[(4-phenylbenzoyl)amino]propyl]-2-(6-ethoxy-6-oxohexoxy)-4-(propanoylamino)oxane-2-carboxylate |
|---|---|
| PubChem CID | 146245144 |
| Molecular Formula | C40H53N3O13 |
| Molecular Weight | 783.87 g/mol |
| Exact Mass | 783.36 |
| IUPAC Name | methyl (2R,4S,5R)-5-acetamido-6-[(1R,2R)-1,2-diacetyloxy-3-[(4-phenylbenzoyl)amino]propyl]-2-(6-ethoxy-6-oxohexoxy)-4-(propanoylamino)oxane-2-carboxylate |
| SMILES | CCOC(=O)CCCCCO[C@]1(C(=O)OC)C[C@H](NC(=O)CC)[C@@H](NC(C)=O)C([C@H](OC(C)=O)[C@@H](CNC(=O)c2ccc(-c3ccccc3)cc2)OC(C)=O)O1 |
| InChI | InChI=1S/C40H53N3O13/c1-7-33(47)43-31-23-40(39(50)51-6,53-22-14-10-13-17-34(48)52-8-2)56-37(35(31)42-25(3)44)36(55-27(5)46)32(54-26(4)45)24-41-38(49)30-20-18-29(19-21-30)28-15-11-9-12-16-28/h9,11-12,15-16,18-21,31-32,35-37H,7-8,10,13-14,17,22-24H2,1-6H3,(H,41,49)(H,42,44)(H,43,47)/t31-,32+,35+,36+,37?,40+/m0/s1 |
| InChIKey | ZSTIVKCOAODKPN-ILZJAWFLSA-N |
| XLogP | 3.14 |
| TPSA | 210.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.87 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|