About S-ethyl 4,4-difluoro-1-(hydroxymethyl)cyclohexane-1-carbothioate
S-ethyl 4,4-difluoro-1-(hydroxymethyl)cyclohexane-1-carbothioate (PubChem CID 123571566) has the molecular formula C10H16F2O2S
and a molecular weight of 238.30 g/mol. Its IUPAC name is S-ethyl 4,4-difluoro-1-(hydroxymethyl)cyclohexane-1-carbothioate.
Molecular Properties
| Compound Name | S-ethyl 4,4-difluoro-1-(hydroxymethyl)cyclohexane-1-carbothioate |
| PubChem CID | 123571566 |
| Molecular Formula | C10H16F2O2S |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | S-ethyl 4,4-difluoro-1-(hydroxymethyl)cyclohexane-1-carbothioate |
| SMILES | CCSC(=O)C1(CO)CCC(F)(F)CC1 |
| InChI | InChI=1S/C10H16F2O2S/c1-2-15-8(14)9(7-13)3-5-10(11,12)6-4-9/h13H,2-7H2,1H3 |
| InChIKey | JLRNUBGRGWAEKB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethyl 4,4-difluoro-1-(hydroxymethyl)cyclohexane-1-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethyl 4,4-difluoro-1-(hydroxymethyl)cyclohexane-1-carbothioate?
The IUPAC name of S-ethyl 4,4-difluoro-1-(hydroxymethyl)cyclohexane-1-carbothioate (CID 123571566) is S-ethyl 4,4-difluoro-1-(hydroxymethyl)cyclohexane-1-carbothioate.
What is the SMILES notation for S-ethyl 4,4-difluoro-1-(hydroxymethyl)cyclohexane-1-carbothioate?
The canonical SMILES for S-ethyl 4,4-difluoro-1-(hydroxymethyl)cyclohexane-1-carbothioate is CCSC(=O)C1(CO)CCC(F)(F)CC1.
What is the InChIKey of S-ethyl 4,4-difluoro-1-(hydroxymethyl)cyclohexane-1-carbothioate?
The InChIKey is JLRNUBGRGWAEKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F2O2S/c1-2-15-8(14)9(7-13)3-5-10(11,12)6-4-9/h13H,2-7H2,1H3.
What are the key properties of S-ethyl 4,4-difluoro-1-(hydroxymethyl)cyclohexane-1-carbothioate?
S-ethyl 4,4-difluoro-1-(hydroxymethyl)cyclohexane-1-carbothioate has a molecular weight of 238.30 g/mol, XLogP of 2.45, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl 4,4-difluoro-1-(hydroxymethyl)cyclohexane-1-carbothioate is sourced from PubChem (CID 123571566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).