C16H29FO2S — CID 10870445
S-cyclohexyl (2R,3R)-2-fluoro-3-hydroxy-2-methylnonanethioate (PubChem CID 10870445) has the molecular formula C16H29FO2S and a molecular weight of 304.47 g/mol. Its IUPAC name is S-cyclohexyl (2R,3R)-2-fluoro-3-hydroxy-2-methylnonanethioate.
| Compound Name | S-cyclohexyl (2R,3R)-2-fluoro-3-hydroxy-2-methylnonanethioate |
|---|---|
| PubChem CID | 10870445 |
| Molecular Formula | C16H29FO2S |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | S-cyclohexyl (2R,3R)-2-fluoro-3-hydroxy-2-methylnonanethioate |
| SMILES | CCCCCC[C@@H](O)[C@@](C)(F)C(=O)SC1CCCCC1 |
| InChI | InChI=1S/C16H29FO2S/c1-3-4-5-9-12-14(18)16(2,17)15(19)20-13-10-7-6-8-11-13/h13-14,18H,3-12H2,1-2H3/t14-,16-/m1/s1 |
| InChIKey | UCUANJPUJXHAOO-GDBMZVCRSA-N |
| XLogP | 4.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|