C38H60O8 — CID 123571756
[1-[18-(3,4-dihydroxyoxan-2-yl)oxy-4,6,11,12,17,17-hexamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docos-5(10)-en-8-yl]-2-hydroxy-2-methylpropyl] acetate (PubChem CID 123571756) has the molecular formula C38H60O8 and a molecular weight of 644.89 g/mol. Its IUPAC name is [1-[18-(3,4-dihydroxyoxan-2-yl)oxy-4,6,11,12,17,17-hexamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docos-5(10)-en-8-yl]-2-hydroxy-2-methylpropyl] acetate.
| Compound Name | [1-[18-(3,4-dihydroxyoxan-2-yl)oxy-4,6,11,12,17,17-hexamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docos-5(10)-en-8-yl]-2-hydroxy-2-methylpropyl] acetate |
|---|---|
| PubChem CID | 123571756 |
| Molecular Formula | C38H60O8 |
| Molecular Weight | 644.89 g/mol |
| Exact Mass | 644.43 |
| IUPAC Name | [1-[18-(3,4-dihydroxyoxan-2-yl)oxy-4,6,11,12,17,17-hexamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docos-5(10)-en-8-yl]-2-hydroxy-2-methylpropyl] acetate |
| SMILES | CC(=O)OC(C1CC(C)C2=C(O1)C(C)C1(C)C3CCC4C(C)(C)C(OC5OCCC(O)C5O)CCC45CC35CCC21C)C(C)(C)O |
| InChI | InChI=1S/C38H60O8/c1-20-18-24(31(34(6,7)42)44-22(3)39)45-30-21(2)36(9)26-11-10-25-33(4,5)27(46-32-29(41)23(40)13-17-43-32)12-14-37(25)19-38(26,37)16-15-35(36,8)28(20)30/h20-21,23-27,29,31-32,40-42H,10-19H2,1-9H3 |
| InChIKey | CYDXZJWFBRKMFM-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.89 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|