C31H50O6 — CID 89436018
(2S,3R,4S)-2-[[(4R,5R,6R,11R,12S,16R,18S,21R)-11-hydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-18-yl]oxy]oxane-3,4-diol (PubChem CID 89436018) has the molecular formula C31H50O6 and a molecular weight of 518.74 g/mol. Its IUPAC name is (2S,3R,4S)-2-[[(4R,5R,6R,11R,12S,16R,18S,21R)-11-hydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-18-yl]oxy]oxane-3,4-diol.
| Compound Name | (2S,3R,4S)-2-[[(4R,5R,6R,11R,12S,16R,18S,21R)-11-hydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-18-yl]oxy]oxane-3,4-diol |
|---|---|
| PubChem CID | 89436018 |
| Molecular Formula | C31H50O6 |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.36 |
| IUPAC Name | (2S,3R,4S)-2-[[(4R,5R,6R,11R,12S,16R,18S,21R)-11-hydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-18-yl]oxy]oxane-3,4-diol |
| SMILES | C[C@@H]1CCOC2[C@H]1[C@@]1(C)CCC34C[C@@]35CC[C@H](O[C@@H]3OCC[C@H](O)[C@H]3O)C(C)(C)[C@@H]5CCC4[C@]1(C)[C@H]2O |
| InChI | InChI=1S/C31H50O6/c1-17-9-14-35-24-22(17)28(4)12-13-31-16-30(31)11-8-21(37-26-23(33)18(32)10-15-36-26)27(2,3)19(30)6-7-20(31)29(28,5)25(24)34/h17-26,32-34H,6-16H2,1-5H3/t17-,18+,19+,20?,21+,22+,23-,24?,25+,26+,28-,29-,30-,31?/m1/s1 |
| InChIKey | XUBAHZWLKAEUMP-BPBWQGSDSA-N |
| XLogP | 4.28 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|