C46H79NO6 — CID 144550722
18-(4-cyclodecylmorpholin-2-yl)oxy-8-(1-ethoxy-2-hydroxy-2-methylpropyl)-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-11-ol (PubChem CID 144550722) has the molecular formula C46H79NO6 and a molecular weight of 742.14 g/mol. Its IUPAC name is 18-(4-cyclodecylmorpholin-2-yl)oxy-8-(1-ethoxy-2-hydroxy-2-methylpropyl)-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-11-ol.
| Compound Name | 18-(4-cyclodecylmorpholin-2-yl)oxy-8-(1-ethoxy-2-hydroxy-2-methylpropyl)-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-11-ol |
|---|---|
| PubChem CID | 144550722 |
| Molecular Formula | C46H79NO6 |
| Molecular Weight | 742.14 g/mol |
| Exact Mass | 741.59 |
| IUPAC Name | 18-(4-cyclodecylmorpholin-2-yl)oxy-8-(1-ethoxy-2-hydroxy-2-methylpropyl)-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-11-ol |
| SMILES | CCOC(C1CC(C)C2C(O1)C(O)C1(C)C3CCC4C(C)(C)C(OC5CN(C6CCCCCCCCC6)CCO5)CCC45CC35CCC21C)C(C)(C)O |
| InChI | InChI=1S/C46H79NO6/c1-9-50-40(42(5,6)49)32-27-30(2)37-38(52-32)39(48)44(8)34-20-19-33-41(3,4)35(21-22-45(33)29-46(34,45)24-23-43(37,44)7)53-36-28-47(25-26-51-36)31-17-15-13-11-10-12-14-16-18-31/h30-40,48-49H,9-29H2,1-8H3 |
| InChIKey | VYYJYMZYTZOQLV-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.14 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |