C42H71NO6 — CID 144550657
18-(4-cyclohexylmorpholin-2-yl)oxy-8-(1-ethoxy-2-hydroxy-2-methylpropyl)-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-11-ol (PubChem CID 144550657) has the molecular formula C42H71NO6 and a molecular weight of 686.03 g/mol. Its IUPAC name is 18-(4-cyclohexylmorpholin-2-yl)oxy-8-(1-ethoxy-2-hydroxy-2-methylpropyl)-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-11-ol.
| Compound Name | 18-(4-cyclohexylmorpholin-2-yl)oxy-8-(1-ethoxy-2-hydroxy-2-methylpropyl)-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-11-ol |
|---|---|
| PubChem CID | 144550657 |
| Molecular Formula | C42H71NO6 |
| Molecular Weight | 686.03 g/mol |
| Exact Mass | 685.53 |
| IUPAC Name | 18-(4-cyclohexylmorpholin-2-yl)oxy-8-(1-ethoxy-2-hydroxy-2-methylpropyl)-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-11-ol |
| SMILES | CCOC(C1CC(C)C2C(O1)C(O)C1(C)C3CCC4C(C)(C)C(OC5CN(C6CCCCC6)CCO5)CCC45CC35CCC21C)C(C)(C)O |
| InChI | InChI=1S/C42H71NO6/c1-9-46-36(38(5,6)45)28-23-26(2)33-34(48-28)35(44)40(8)30-16-15-29-37(3,4)31(17-18-41(29)25-42(30,41)20-19-39(33,40)7)49-32-24-43(21-22-47-32)27-13-11-10-12-14-27/h26-36,44-45H,9-25H2,1-8H3 |
| InChIKey | DPSBGOSEEYOORJ-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.03 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |