C21H17ClF3N4O3+ — CID 123571920
7-[(4-chlorophenyl)methyl]-3,3-dimethyl-8-[3-(trifluoromethyl)phenoxy]purin-3-ium-2,6-dione (PubChem CID 123571920) has the molecular formula C21H17ClF3N4O3+ and a molecular weight of 465.84 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-3,3-dimethyl-8-[3-(trifluoromethyl)phenoxy]purin-3-ium-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-3,3-dimethyl-8-[3-(trifluoromethyl)phenoxy]purin-3-ium-2,6-dione |
|---|---|
| PubChem CID | 123571920 |
| Molecular Formula | C21H17ClF3N4O3+ |
| Molecular Weight | 465.84 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-3,3-dimethyl-8-[3-(trifluoromethyl)phenoxy]purin-3-ium-2,6-dione |
| SMILES | C[N+]1(C)C(=O)NC(=O)c2c1nc(Oc1cccc(C(F)(F)F)c1)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H16ClF3N4O3/c1-29(2)17-16(18(30)27-20(29)31)28(11-12-6-8-14(22)9-7-12)19(26-17)32-15-5-3-4-13(10-15)21(23,24)25/h3-10H,11H2,1-2H3/p+1 |
| InChIKey | AKEBFGUCPCPZFR-UHFFFAOYSA-O |
| XLogP | 4.83 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.84 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|