C29H24F2N4O4S — CID 123572128
[4-(4-fluoro-3-methanimidoylphenyl)sulfonylpiperazin-1-yl]-[6-[4-(4-fluorophenoxy)phenyl]-2-pyridinyl]methanone (PubChem CID 123572128) has the molecular formula C29H24F2N4O4S and a molecular weight of 562.60 g/mol. Its IUPAC name is [4-(4-fluoro-3-methanimidoylphenyl)sulfonylpiperazin-1-yl]-[6-[4-(4-fluorophenoxy)phenyl]-2-pyridinyl]methanone.
| Compound Name | [4-(4-fluoro-3-methanimidoylphenyl)sulfonylpiperazin-1-yl]-[6-[4-(4-fluorophenoxy)phenyl]-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 123572128 |
| Molecular Formula | C29H24F2N4O4S |
| Molecular Weight | 562.60 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | [4-(4-fluoro-3-methanimidoylphenyl)sulfonylpiperazin-1-yl]-[6-[4-(4-fluorophenoxy)phenyl]-2-pyridinyl]methanone |
| SMILES | [H]/N=C/c1cc(S(=O)(=O)N2CCN(C(=O)c3cccc(-c4ccc(Oc5ccc(F)cc5)cc4)n3)CC2)ccc1F |
| InChI | InChI=1S/C29H24F2N4O4S/c30-22-6-10-24(11-7-22)39-23-8-4-20(5-9-23)27-2-1-3-28(33-27)29(36)34-14-16-35(17-15-34)40(37,38)25-12-13-26(31)21(18-25)19-32/h1-13,18-19,32H,14-17H2/b32-19+ |
| InChIKey | NVCBZCZJXXNOQC-BIZUNTBRSA-N |
| XLogP | 4.96 |
| TPSA | 103.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|