C27H29FN4O2 — CID 147614300
[6-[4-(4-fluorophenoxy)phenyl]-4-piperidin-1-yl-2-pyridinyl]-piperazin-1-ylmethanone (PubChem CID 147614300) has the molecular formula C27H29FN4O2 and a molecular weight of 460.55 g/mol. Its IUPAC name is [6-[4-(4-fluorophenoxy)phenyl]-4-piperidin-1-yl-2-pyridinyl]-piperazin-1-ylmethanone.
| Compound Name | [6-[4-(4-fluorophenoxy)phenyl]-4-piperidin-1-yl-2-pyridinyl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 147614300 |
| Molecular Formula | C27H29FN4O2 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | [6-[4-(4-fluorophenoxy)phenyl]-4-piperidin-1-yl-2-pyridinyl]-piperazin-1-ylmethanone |
| SMILES | O=C(c1cc(N2CCCCC2)cc(-c2ccc(Oc3ccc(F)cc3)cc2)n1)N1CCNCC1 |
| InChI | InChI=1S/C27H29FN4O2/c28-21-6-10-24(11-7-21)34-23-8-4-20(5-9-23)25-18-22(31-14-2-1-3-15-31)19-26(30-25)27(33)32-16-12-29-13-17-32/h4-11,18-19,29H,1-3,12-17H2 |
| InChIKey | GCPJIFMYPGPBHF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |