C21H22F2N8 — CID 123572418
1-[6-[2-amino-4-fluoro-5-(1-imino-3-methyliminopropan-2-yl)benzenecarboximidoyl]pyrimidin-4-yl]-4-fluoropiperidine-4-carbonitrile (PubChem CID 123572418) has the molecular formula C21H22F2N8 and a molecular weight of 424.46 g/mol. Its IUPAC name is 1-[6-[2-amino-4-fluoro-5-(1-imino-3-methyliminopropan-2-yl)benzenecarboximidoyl]pyrimidin-4-yl]-4-fluoropiperidine-4-carbonitrile.
| Compound Name | 1-[6-[2-amino-4-fluoro-5-(1-imino-3-methyliminopropan-2-yl)benzenecarboximidoyl]pyrimidin-4-yl]-4-fluoropiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 123572418 |
| Molecular Formula | C21H22F2N8 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 1-[6-[2-amino-4-fluoro-5-(1-imino-3-methyliminopropan-2-yl)benzenecarboximidoyl]pyrimidin-4-yl]-4-fluoropiperidine-4-carbonitrile |
| SMILES | [H]/N=C\C(/C=N/C)c1cc(/C(=N/[H])c2cc(N3CCC(F)(C#N)CC3)ncn2)c(N)cc1F |
| InChI | InChI=1S/C21H22F2N8/c1-28-10-13(9-24)14-6-15(17(26)7-16(14)22)20(27)18-8-19(30-12-29-18)31-4-2-21(23,11-25)3-5-31/h6-10,12-13,24,27H,2-5,26H2,1H3/b24-9-,27-20-,28-10+ |
| InChIKey | QUIHTDSHARDDJH-FTPZZVPOSA-N |
| XLogP | 2.88 |
| TPSA | 138.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|