C44H55N5O6S — CID 123572722
methyl 10a-amino-4-[[2,5-dibenzyl-6-oxo-6-[(2-oxo-1-phenylazocan-3-yl)amino]hexanoyl]amino]-5-oxo-3,4,7,8,9,10-hexahydro-2H-pyrido[2,1-b][1,3]thiazepine-7-carboxylate (PubChem CID 123572722) has the molecular formula C44H55N5O6S and a molecular weight of 782.02 g/mol. Its IUPAC name is methyl 10a-amino-4-[[2,5-dibenzyl-6-oxo-6-[(2-oxo-1-phenylazocan-3-yl)amino]hexanoyl]amino]-5-oxo-3,4,7,8,9,10-hexahydro-2H-pyrido[2,1-b][1,3]thiazepine-7-carboxylate.
| Compound Name | methyl 10a-amino-4-[[2,5-dibenzyl-6-oxo-6-[(2-oxo-1-phenylazocan-3-yl)amino]hexanoyl]amino]-5-oxo-3,4,7,8,9,10-hexahydro-2H-pyrido[2,1-b][1,3]thiazepine-7-carboxylate |
|---|---|
| PubChem CID | 123572722 |
| Molecular Formula | C44H55N5O6S |
| Molecular Weight | 782.02 g/mol |
| Exact Mass | 781.39 |
| IUPAC Name | methyl 10a-amino-4-[[2,5-dibenzyl-6-oxo-6-[(2-oxo-1-phenylazocan-3-yl)amino]hexanoyl]amino]-5-oxo-3,4,7,8,9,10-hexahydro-2H-pyrido[2,1-b][1,3]thiazepine-7-carboxylate |
| SMILES | COC(=O)C1CCCC2(N)SCCC(NC(=O)C(CCC(Cc3ccccc3)C(=O)NC3CCCCCN(c4ccccc4)C3=O)Cc3ccccc3)C(=O)N12 |
| InChI | InChI=1S/C44H55N5O6S/c1-55-43(54)38-22-14-26-44(45)49(38)42(53)37(25-28-56-44)47-40(51)34(30-32-17-8-3-9-18-32)24-23-33(29-31-15-6-2-7-16-31)39(50)46-36-21-12-5-13-27-48(41(36)52)35-19-10-4-11-20-35/h2-4,6-11,15-20,33-34,36-38H,5,12-14,21-30,45H2,1H3,(H,46,50)(H,47,51) |
| InChIKey | AUUJFYWTHCQKHV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 151.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.02 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |