C23H31N5O4S — CID 123573187
CID 123573187 (PubChem CID 123573187) has the molecular formula C23H31N5O4S and a molecular weight of 473.60 g/mol.
| Compound Name | CID 123573187 |
|---|---|
| PubChem CID | 123573187 |
| Molecular Formula | C23H31N5O4S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | — |
| SMILES | Cc1ccc([C@H](C)N2C(=O)[C@@H]3C[C@H]2CN3C[C@H](C)C(=O)N2CCC[C@H]2C#N)cc1.N=S(=O)=O |
| InChI | InChI=1S/C23H30N4O2.HNO2S/c1-15-6-8-18(9-7-15)17(3)27-20-11-21(23(27)29)25(14-20)13-16(2)22(28)26-10-4-5-19(26)12-24;1-4(2)3/h6-9,16-17,19-21H,4-5,10-11,13-14H2,1-3H3;1H/t16-,17-,19-,20-,21-;/m0./s1 |
| InChIKey | SMILKXOJFYMQEG-VLCUGXBSSA-N |
| XLogP | 2.12 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |