C55H56N8O2 — CID 123573578
ethyl 4-[[4,6-bis[(3-methylphenyl)methyl]-1,3,5-triazin-2-yl]amino]benzoate;N-(2-ethylphenyl)-4,6-bis[(3-methylphenyl)methyl]-1,3,5-triazin-2-amine (PubChem CID 123573578) has the molecular formula C55H56N8O2 and a molecular weight of 861.11 g/mol. Its IUPAC name is ethyl 4-[[4,6-bis[(3-methylphenyl)methyl]-1,3,5-triazin-2-yl]amino]benzoate;N-(2-ethylphenyl)-4,6-bis[(3-methylphenyl)methyl]-1,3,5-triazin-2-amine.
| Compound Name | ethyl 4-[[4,6-bis[(3-methylphenyl)methyl]-1,3,5-triazin-2-yl]amino]benzoate;N-(2-ethylphenyl)-4,6-bis[(3-methylphenyl)methyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 123573578 |
| Molecular Formula | C55H56N8O2 |
| Molecular Weight | 861.11 g/mol |
| Exact Mass | 860.45 |
| IUPAC Name | ethyl 4-[[4,6-bis[(3-methylphenyl)methyl]-1,3,5-triazin-2-yl]amino]benzoate;N-(2-ethylphenyl)-4,6-bis[(3-methylphenyl)methyl]-1,3,5-triazin-2-amine |
| SMILES | CCOC(=O)c1ccc(Nc2nc(Cc3cccc(C)c3)nc(Cc3cccc(C)c3)n2)cc1.CCc1ccccc1Nc1nc(Cc2cccc(C)c2)nc(Cc2cccc(C)c2)n1 |
| InChI | InChI=1S/C28H28N4O2.C27H28N4/c1-4-34-27(33)23-11-13-24(14-12-23)29-28-31-25(17-21-9-5-7-19(2)15-21)30-26(32-28)18-22-10-6-8-20(3)16-22;1-4-23-13-5-6-14-24(23)28-27-30-25(17-21-11-7-9-19(2)15-21)29-26(31-27)18-22-12-8-10-20(3)16-22/h5-16H,4,17-18H2,1-3H3,(H,29,30,31,32);5-16H,4,17-18H2,1-3H3,(H,28,29,30,31) |
| InChIKey | ZYDSCEYBEAXVNW-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 127.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.11 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |