C22H16BrF3O — CID 123573993
1-(4-bromophenyl)-1-(2-methylphenyl)-3-(2,3,5-trifluorophenyl)propan-2-one (PubChem CID 123573993) has the molecular formula C22H16BrF3O and a molecular weight of 433.27 g/mol. Its IUPAC name is 1-(4-bromophenyl)-1-(2-methylphenyl)-3-(2,3,5-trifluorophenyl)propan-2-one.
| Compound Name | 1-(4-bromophenyl)-1-(2-methylphenyl)-3-(2,3,5-trifluorophenyl)propan-2-one |
|---|---|
| PubChem CID | 123573993 |
| Molecular Formula | C22H16BrF3O |
| Molecular Weight | 433.27 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | 1-(4-bromophenyl)-1-(2-methylphenyl)-3-(2,3,5-trifluorophenyl)propan-2-one |
| SMILES | Cc1ccccc1C(C(=O)Cc1cc(F)cc(F)c1F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H16BrF3O/c1-13-4-2-3-5-18(13)21(14-6-8-16(23)9-7-14)20(27)11-15-10-17(24)12-19(25)22(15)26/h2-10,12,21H,11H2,1H3 |
| InChIKey | VTFLTTCOLRZAIJ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.27 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|