C16H15BrO2 — CID 67015622
3-(4-bromophenyl)-3-(2-methylphenyl)propanoic acid (PubChem CID 67015622) has the molecular formula C16H15BrO2 and a molecular weight of 319.20 g/mol. Its IUPAC name is 3-(4-bromophenyl)-3-(2-methylphenyl)propanoic acid.
| Compound Name | 3-(4-bromophenyl)-3-(2-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 67015622 |
| Molecular Formula | C16H15BrO2 |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 3-(4-bromophenyl)-3-(2-methylphenyl)propanoic acid |
| SMILES | Cc1ccccc1C(CC(=O)O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H15BrO2/c1-11-4-2-3-5-14(11)15(10-16(18)19)12-6-8-13(17)9-7-12/h2-9,15H,10H2,1H3,(H,18,19) |
| InChIKey | KOMCNZSWRAEXAH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |