C22H18BrCl2NO — CID 76671396
N-[3-(4-bromophenyl)-1-(2,5-dichlorophenyl)-3-(2-methylphenyl)propylidene]hydroxylamine (PubChem CID 76671396) has the molecular formula C22H18BrCl2NO and a molecular weight of 463.20 g/mol. Its IUPAC name is N-[3-(4-bromophenyl)-1-(2,5-dichlorophenyl)-3-(2-methylphenyl)propylidene]hydroxylamine.
| Compound Name | N-[3-(4-bromophenyl)-1-(2,5-dichlorophenyl)-3-(2-methylphenyl)propylidene]hydroxylamine |
|---|---|
| PubChem CID | 76671396 |
| Molecular Formula | C22H18BrCl2NO |
| Molecular Weight | 463.20 g/mol |
| Exact Mass | 460.99 |
| IUPAC Name | N-[3-(4-bromophenyl)-1-(2,5-dichlorophenyl)-3-(2-methylphenyl)propylidene]hydroxylamine |
| SMILES | Cc1ccccc1C(CC(=NO)c1cc(Cl)ccc1Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H18BrCl2NO/c1-14-4-2-3-5-18(14)19(15-6-8-16(23)9-7-15)13-22(26-27)20-12-17(24)10-11-21(20)25/h2-12,19,27H,13H2,1H3 |
| InChIKey | MFYXBBJOMSUTBF-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.20 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|