C21H24BrNO2 — CID 78110471
N-[3-(4-bromophenyl)-3-(2-methylphenyl)-1-(oxan-4-yl)propylidene]hydroxylamine (PubChem CID 78110471) has the molecular formula C21H24BrNO2 and a molecular weight of 402.33 g/mol. Its IUPAC name is N-[3-(4-bromophenyl)-3-(2-methylphenyl)-1-(oxan-4-yl)propylidene]hydroxylamine.
| Compound Name | N-[3-(4-bromophenyl)-3-(2-methylphenyl)-1-(oxan-4-yl)propylidene]hydroxylamine |
|---|---|
| PubChem CID | 78110471 |
| Molecular Formula | C21H24BrNO2 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | N-[3-(4-bromophenyl)-3-(2-methylphenyl)-1-(oxan-4-yl)propylidene]hydroxylamine |
| SMILES | Cc1ccccc1C(CC(=NO)C1CCOCC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H24BrNO2/c1-15-4-2-3-5-19(15)20(16-6-8-18(22)9-7-16)14-21(23-24)17-10-12-25-13-11-17/h2-9,17,20,24H,10-14H2,1H3 |
| InChIKey | VNMRCOWWLIWMNF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|