C29H30N2O4 — CID 71555708
4-[4-[(1R,3E)-3-hydroxyimino-3-(1-methyl-6-oxopiperidin-3-yl)-1-(2-methylphenyl)propyl]phenyl]benzoic acid (PubChem CID 71555708) has the molecular formula C29H30N2O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is 4-[4-[(1R,3E)-3-hydroxyimino-3-(1-methyl-6-oxopiperidin-3-yl)-1-(2-methylphenyl)propyl]phenyl]benzoic acid.
| Compound Name | 4-[4-[(1R,3E)-3-hydroxyimino-3-(1-methyl-6-oxopiperidin-3-yl)-1-(2-methylphenyl)propyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 71555708 |
| Molecular Formula | C29H30N2O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 4-[4-[(1R,3E)-3-hydroxyimino-3-(1-methyl-6-oxopiperidin-3-yl)-1-(2-methylphenyl)propyl]phenyl]benzoic acid |
| SMILES | Cc1ccccc1[C@H](C/C(=N\O)C1CCC(=O)N(C)C1)c1ccc(-c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C29H30N2O4/c1-19-5-3-4-6-25(19)26(17-27(30-35)24-15-16-28(32)31(2)18-24)22-11-7-20(8-12-22)21-9-13-23(14-10-21)29(33)34/h3-14,24,26,35H,15-18H2,1-2H3,(H,33,34)/b30-27+/t24?,26-/m1/s1 |
| InChIKey | SNWLAIBGMLMZAM-PJKILBEVSA-N |
| XLogP | 5.58 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|