C30H38N2O4 — CID 86682603
ethyl 1-[4-[(1R)-3-(1-methyl-6-oxopiperidin-3-yl)-1-(2-methylphenyl)-3-oxopropyl]phenyl]piperidine-4-carboxylate (PubChem CID 86682603) has the molecular formula C30H38N2O4 and a molecular weight of 490.64 g/mol. Its IUPAC name is ethyl 1-[4-[(1R)-3-(1-methyl-6-oxopiperidin-3-yl)-1-(2-methylphenyl)-3-oxopropyl]phenyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-[(1R)-3-(1-methyl-6-oxopiperidin-3-yl)-1-(2-methylphenyl)-3-oxopropyl]phenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 86682603 |
| Molecular Formula | C30H38N2O4 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | ethyl 1-[4-[(1R)-3-(1-methyl-6-oxopiperidin-3-yl)-1-(2-methylphenyl)-3-oxopropyl]phenyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc([C@@H](CC(=O)C3CCC(=O)N(C)C3)c3ccccc3C)cc2)CC1 |
| InChI | InChI=1S/C30H38N2O4/c1-4-36-30(35)23-15-17-32(18-16-23)25-12-9-22(10-13-25)27(26-8-6-5-7-21(26)2)19-28(33)24-11-14-29(34)31(3)20-24/h5-10,12-13,23-24,27H,4,11,14-20H2,1-3H3/t24?,27-/m1/s1 |
| InChIKey | QUBFWTFVPQCMRF-LFHRXCRSSA-N |
| XLogP | 4.73 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|