C30H35N3O3 — CID 173039163
ethyl 1-[4-[(1R)-3-hydroxyimino-1-(2-methylphenyl)-3-(2-methyl-4-pyridinyl)propyl]phenyl]piperidine-4-carboxylate (PubChem CID 173039163) has the molecular formula C30H35N3O3 and a molecular weight of 485.63 g/mol. Its IUPAC name is ethyl 1-[4-[(1R)-3-hydroxyimino-1-(2-methylphenyl)-3-(2-methyl-4-pyridinyl)propyl]phenyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-[(1R)-3-hydroxyimino-1-(2-methylphenyl)-3-(2-methyl-4-pyridinyl)propyl]phenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 173039163 |
| Molecular Formula | C30H35N3O3 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | ethyl 1-[4-[(1R)-3-hydroxyimino-1-(2-methylphenyl)-3-(2-methyl-4-pyridinyl)propyl]phenyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc([C@@H](CC(=NO)c3ccnc(C)c3)c3ccccc3C)cc2)CC1 |
| InChI | InChI=1S/C30H35N3O3/c1-4-36-30(34)24-14-17-33(18-15-24)26-11-9-23(10-12-26)28(27-8-6-5-7-21(27)2)20-29(32-35)25-13-16-31-22(3)19-25/h5-13,16,19,24,28,35H,4,14-15,17-18,20H2,1-3H3/t28-/m1/s1 |
| InChIKey | JBIJJCAUWBIRGU-MUUNZHRXSA-N |
| XLogP | 5.88 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|