C30H33ClN2O3 — CID 66667412
ethyl 1-[4-[(1R)-1-(4-chloro-2-methylphenyl)-3-(2-methyl-4-pyridinyl)-3-oxopropyl]phenyl]piperidine-4-carboxylate (PubChem CID 66667412) has the molecular formula C30H33ClN2O3 and a molecular weight of 505.06 g/mol. Its IUPAC name is ethyl 1-[4-[(1R)-1-(4-chloro-2-methylphenyl)-3-(2-methyl-4-pyridinyl)-3-oxopropyl]phenyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-[(1R)-1-(4-chloro-2-methylphenyl)-3-(2-methyl-4-pyridinyl)-3-oxopropyl]phenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 66667412 |
| Molecular Formula | C30H33ClN2O3 |
| Molecular Weight | 505.06 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | ethyl 1-[4-[(1R)-1-(4-chloro-2-methylphenyl)-3-(2-methyl-4-pyridinyl)-3-oxopropyl]phenyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc([C@@H](CC(=O)c3ccnc(C)c3)c3ccc(Cl)cc3C)cc2)CC1 |
| InChI | InChI=1S/C30H33ClN2O3/c1-4-36-30(35)23-12-15-33(16-13-23)26-8-5-22(6-9-26)28(27-10-7-25(31)17-20(27)2)19-29(34)24-11-14-32-21(3)18-24/h5-11,14,17-18,23,28H,4,12-13,15-16,19H2,1-3H3/t28-/m1/s1 |
| InChIKey | QUTDTTDVQOSQQG-MUUNZHRXSA-N |
| XLogP | 6.54 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.06 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|