C28H31N3O4 — CID 136622810
[1-[4-[(1S,3E)-3-hydroxyimino-1-(2-methylphenyl)-3-(2-methyl-4-pyridinyl)propyl]phenyl]piperidin-4-yl] hydrogen carbonate (PubChem CID 136622810) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is [1-[4-[(1S,3E)-3-hydroxyimino-1-(2-methylphenyl)-3-(2-methyl-4-pyridinyl)propyl]phenyl]piperidin-4-yl] hydrogen carbonate.
| Compound Name | [1-[4-[(1S,3E)-3-hydroxyimino-1-(2-methylphenyl)-3-(2-methyl-4-pyridinyl)propyl]phenyl]piperidin-4-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 136622810 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | [1-[4-[(1S,3E)-3-hydroxyimino-1-(2-methylphenyl)-3-(2-methyl-4-pyridinyl)propyl]phenyl]piperidin-4-yl] hydrogen carbonate |
| SMILES | Cc1cc(/C(C[C@@H](c2ccc(N3CCC(OC(=O)O)CC3)cc2)c2ccccc2C)=N/O)ccn1 |
| InChI | InChI=1S/C28H31N3O4/c1-19-5-3-4-6-25(19)26(18-27(30-34)22-11-14-29-20(2)17-22)21-7-9-23(10-8-21)31-15-12-24(13-16-31)35-28(32)33/h3-11,14,17,24,26,34H,12-13,15-16,18H2,1-2H3,(H,32,33)/b30-27+/t26-/m0/s1 |
| InChIKey | FZWWYKVMAYVNOX-MMZFVREHSA-N |
| XLogP | 5.76 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|