C30H28N2O3 — CID 173039146
methyl 4-[3-[(3Z)-3-hydroxyimino-1-(2-methylphenyl)-3-(2-methyl-4-pyridinyl)propyl]phenyl]benzoate (PubChem CID 173039146) has the molecular formula C30H28N2O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is methyl 4-[3-[(3Z)-3-hydroxyimino-1-(2-methylphenyl)-3-(2-methyl-4-pyridinyl)propyl]phenyl]benzoate.
| Compound Name | methyl 4-[3-[(3Z)-3-hydroxyimino-1-(2-methylphenyl)-3-(2-methyl-4-pyridinyl)propyl]phenyl]benzoate |
|---|---|
| PubChem CID | 173039146 |
| Molecular Formula | C30H28N2O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | methyl 4-[3-[(3Z)-3-hydroxyimino-1-(2-methylphenyl)-3-(2-methyl-4-pyridinyl)propyl]phenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cccc(C(C/C(=N/O)c3ccnc(C)c3)c3ccccc3C)c2)cc1 |
| InChI | InChI=1S/C30H28N2O3/c1-20-7-4-5-10-27(20)28(19-29(32-34)26-15-16-31-21(2)17-26)25-9-6-8-24(18-25)22-11-13-23(14-12-22)30(33)35-3/h4-18,28,34H,19H2,1-3H3/b32-29- |
| InChIKey | SIBYVRVYLOMMQM-OVXWJCGASA-N |
| XLogP | 6.55 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|