C30H28N2O3 — CID 152775617
4-[4-[(1R)-3-(2,6-dimethyl-4-pyridinyl)-3-hydroxyimino-1-(2-methylphenyl)propyl]phenyl]benzoic acid (PubChem CID 152775617) has the molecular formula C30H28N2O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is 4-[4-[(1R)-3-(2,6-dimethyl-4-pyridinyl)-3-hydroxyimino-1-(2-methylphenyl)propyl]phenyl]benzoic acid.
| Compound Name | 4-[4-[(1R)-3-(2,6-dimethyl-4-pyridinyl)-3-hydroxyimino-1-(2-methylphenyl)propyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 152775617 |
| Molecular Formula | C30H28N2O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 4-[4-[(1R)-3-(2,6-dimethyl-4-pyridinyl)-3-hydroxyimino-1-(2-methylphenyl)propyl]phenyl]benzoic acid |
| SMILES | Cc1cc(C(C[C@H](c2ccc(-c3ccc(C(=O)O)cc3)cc2)c2ccccc2C)=NO)cc(C)n1 |
| InChI | InChI=1S/C30H28N2O3/c1-19-6-4-5-7-27(19)28(18-29(32-35)26-16-20(2)31-21(3)17-26)24-12-8-22(9-13-24)23-10-14-25(15-11-23)30(33)34/h4-17,28,35H,18H2,1-3H3,(H,33,34)/t28-/m1/s1 |
| InChIKey | HGXFVTDVHWBUDV-MUUNZHRXSA-N |
| XLogP | 6.77 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|