C26H21F2N3O — CID 76671564
N-[1-(3,5-difluorophenyl)-3-(2-methylphenyl)-3-(4-pyrimidin-5-ylphenyl)propylidene]hydroxylamine (PubChem CID 76671564) has the molecular formula C26H21F2N3O and a molecular weight of 429.47 g/mol. Its IUPAC name is N-[1-(3,5-difluorophenyl)-3-(2-methylphenyl)-3-(4-pyrimidin-5-ylphenyl)propylidene]hydroxylamine.
| Compound Name | N-[1-(3,5-difluorophenyl)-3-(2-methylphenyl)-3-(4-pyrimidin-5-ylphenyl)propylidene]hydroxylamine |
|---|---|
| PubChem CID | 76671564 |
| Molecular Formula | C26H21F2N3O |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | N-[1-(3,5-difluorophenyl)-3-(2-methylphenyl)-3-(4-pyrimidin-5-ylphenyl)propylidene]hydroxylamine |
| SMILES | Cc1ccccc1C(CC(=NO)c1cc(F)cc(F)c1)c1ccc(-c2cncnc2)cc1 |
| InChI | InChI=1S/C26H21F2N3O/c1-17-4-2-3-5-24(17)25(13-26(31-32)20-10-22(27)12-23(28)11-20)19-8-6-18(7-9-19)21-14-29-16-30-15-21/h2-12,14-16,25,32H,13H2,1H3 |
| InChIKey | OYTNCUIYIPPWNV-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|