C27H23N3O4 — CID 136988106
[4-[4-[(3E)-3-hydroxyimino-1-(2-methylphenyl)-3-pyridazin-4-ylpropyl]phenyl]phenyl] hydrogen carbonate (PubChem CID 136988106) has the molecular formula C27H23N3O4 and a molecular weight of 453.50 g/mol. Its IUPAC name is [4-[4-[(3E)-3-hydroxyimino-1-(2-methylphenyl)-3-pyridazin-4-ylpropyl]phenyl]phenyl] hydrogen carbonate.
| Compound Name | [4-[4-[(3E)-3-hydroxyimino-1-(2-methylphenyl)-3-pyridazin-4-ylpropyl]phenyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 136988106 |
| Molecular Formula | C27H23N3O4 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | [4-[4-[(3E)-3-hydroxyimino-1-(2-methylphenyl)-3-pyridazin-4-ylpropyl]phenyl]phenyl] hydrogen carbonate |
| SMILES | Cc1ccccc1C(C/C(=N\O)c1ccnnc1)c1ccc(-c2ccc(OC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C27H23N3O4/c1-18-4-2-3-5-24(18)25(16-26(30-33)22-14-15-28-29-17-22)21-8-6-19(7-9-21)20-10-12-23(13-11-20)34-27(31)32/h2-15,17,25,33H,16H2,1H3,(H,31,32)/b30-26+ |
| InChIKey | MVTLJVUFZCFQOI-URGPHPNLSA-N |
| XLogP | 5.91 |
| TPSA | 104.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|