C28H25N3O5 — CID 136988110
[4-[4-[(1R,3E)-3-hydroxyimino-3-(1-methyl-6-oxopyridazin-3-yl)-1-(2-methylphenyl)propyl]phenyl]phenyl] hydrogen carbonate (PubChem CID 136988110) has the molecular formula C28H25N3O5 and a molecular weight of 483.52 g/mol. Its IUPAC name is [4-[4-[(1R,3E)-3-hydroxyimino-3-(1-methyl-6-oxopyridazin-3-yl)-1-(2-methylphenyl)propyl]phenyl]phenyl] hydrogen carbonate.
| Compound Name | [4-[4-[(1R,3E)-3-hydroxyimino-3-(1-methyl-6-oxopyridazin-3-yl)-1-(2-methylphenyl)propyl]phenyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 136988110 |
| Molecular Formula | C28H25N3O5 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | [4-[4-[(1R,3E)-3-hydroxyimino-3-(1-methyl-6-oxopyridazin-3-yl)-1-(2-methylphenyl)propyl]phenyl]phenyl] hydrogen carbonate |
| SMILES | Cc1ccccc1[C@H](C/C(=N\O)c1ccc(=O)n(C)n1)c1ccc(-c2ccc(OC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C28H25N3O5/c1-18-5-3-4-6-23(18)24(17-26(30-35)25-15-16-27(32)31(2)29-25)21-9-7-19(8-10-21)20-11-13-22(14-12-20)36-28(33)34/h3-16,24,35H,17H2,1-2H3,(H,33,34)/b30-26+/t24-/m1/s1 |
| InChIKey | XHRMLTVPFUVYTA-WDTBYNAESA-N |
| XLogP | 5.21 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|