C28H22ClFN2O4 — CID 136622779
[4-[4-[(3E)-1-(4-chloro-2-fluorophenyl)-3-hydroxyimino-3-(2-methyl-4-pyridinyl)propyl]phenyl]phenyl] hydrogen carbonate (PubChem CID 136622779) has the molecular formula C28H22ClFN2O4 and a molecular weight of 504.95 g/mol. Its IUPAC name is [4-[4-[(3E)-1-(4-chloro-2-fluorophenyl)-3-hydroxyimino-3-(2-methyl-4-pyridinyl)propyl]phenyl]phenyl] hydrogen carbonate.
| Compound Name | [4-[4-[(3E)-1-(4-chloro-2-fluorophenyl)-3-hydroxyimino-3-(2-methyl-4-pyridinyl)propyl]phenyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 136622779 |
| Molecular Formula | C28H22ClFN2O4 |
| Molecular Weight | 504.95 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | [4-[4-[(3E)-1-(4-chloro-2-fluorophenyl)-3-hydroxyimino-3-(2-methyl-4-pyridinyl)propyl]phenyl]phenyl] hydrogen carbonate |
| SMILES | Cc1cc(/C(CC(c2ccc(-c3ccc(OC(=O)O)cc3)cc2)c2ccc(Cl)cc2F)=N/O)ccn1 |
| InChI | InChI=1S/C28H22ClFN2O4/c1-17-14-21(12-13-31-17)27(32-35)16-25(24-11-8-22(29)15-26(24)30)20-4-2-18(3-5-20)19-6-9-23(10-7-19)36-28(33)34/h2-15,25,35H,16H2,1H3,(H,33,34)/b32-27+ |
| InChIKey | PMIWHWLIWZNTJX-QVAGMWBUSA-N |
| XLogP | 7.31 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.95 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|