C28H21ClF2N2O4 — CID 173039149
4-[4-[(1S)-1-(4-chloro-2-fluorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]phenyl]-2-fluorobenzoic acid (PubChem CID 173039149) has the molecular formula C28H21ClF2N2O4 and a molecular weight of 522.94 g/mol. Its IUPAC name is 4-[4-[(1S)-1-(4-chloro-2-fluorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]phenyl]-2-fluorobenzoic acid.
| Compound Name | 4-[4-[(1S)-1-(4-chloro-2-fluorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]phenyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 173039149 |
| Molecular Formula | C28H21ClF2N2O4 |
| Molecular Weight | 522.94 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | 4-[4-[(1S)-1-(4-chloro-2-fluorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]phenyl]-2-fluorobenzoic acid |
| SMILES | Cn1cc(C(C[C@@H](c2ccc(-c3ccc(C(=O)O)c(F)c3)cc2)c2ccc(Cl)cc2F)=NO)ccc1=O |
| InChI | InChI=1S/C28H21ClF2N2O4/c1-33-15-19(7-11-27(33)34)26(32-37)14-23(21-10-8-20(29)13-25(21)31)17-4-2-16(3-5-17)18-6-9-22(28(35)36)24(30)12-18/h2-13,15,23,37H,14H2,1H3,(H,35,36)/t23-/m0/s1 |
| InChIKey | BDCKLOZRBQWAOO-QHCPKHFHSA-N |
| XLogP | 6.08 |
| TPSA | 91.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.94 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|