C29H24ClN3O2 — CID 58043287
4-[4-[(3E)-1-(4-chloro-2-methylphenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]phenyl]benzonitrile (PubChem CID 58043287) has the molecular formula C29H24ClN3O2 and a molecular weight of 481.98 g/mol. Its IUPAC name is 4-[4-[(3E)-1-(4-chloro-2-methylphenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]phenyl]benzonitrile.
| Compound Name | 4-[4-[(3E)-1-(4-chloro-2-methylphenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 58043287 |
| Molecular Formula | C29H24ClN3O2 |
| Molecular Weight | 481.98 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 4-[4-[(3E)-1-(4-chloro-2-methylphenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]phenyl]benzonitrile |
| SMILES | Cc1cc(Cl)ccc1C(C/C(=N\O)c1ccc(=O)n(C)c1)c1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C29H24ClN3O2/c1-19-15-25(30)12-13-26(19)27(16-28(32-35)24-11-14-29(34)33(2)18-24)23-9-7-22(8-10-23)21-5-3-20(17-31)4-6-21/h3-15,18,27,35H,16H2,1-2H3/b32-28+ |
| InChIKey | ZUHKGLQESGBVJC-VEWQFJOQSA-N |
| XLogP | 6.29 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.98 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|