C25H26ClFN2O3 — CID 86661135
5-[(Z)-C-[2-(4-chloro-2-methylphenyl)-2-(3-fluoro-4-propan-2-yloxyphenyl)ethyl]-N-hydroxycarbonimidoyl]-1-methylpyridin-2-one (PubChem CID 86661135) has the molecular formula C25H26ClFN2O3 and a molecular weight of 456.95 g/mol. Its IUPAC name is 5-[(Z)-C-[2-(4-chloro-2-methylphenyl)-2-(3-fluoro-4-propan-2-yloxyphenyl)ethyl]-N-hydroxycarbonimidoyl]-1-methylpyridin-2-one.
| Compound Name | 5-[(Z)-C-[2-(4-chloro-2-methylphenyl)-2-(3-fluoro-4-propan-2-yloxyphenyl)ethyl]-N-hydroxycarbonimidoyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 86661135 |
| Molecular Formula | C25H26ClFN2O3 |
| Molecular Weight | 456.95 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 5-[(Z)-C-[2-(4-chloro-2-methylphenyl)-2-(3-fluoro-4-propan-2-yloxyphenyl)ethyl]-N-hydroxycarbonimidoyl]-1-methylpyridin-2-one |
| SMILES | Cc1cc(Cl)ccc1C(C/C(=N/O)c1ccc(=O)n(C)c1)c1ccc(OC(C)C)c(F)c1 |
| InChI | InChI=1S/C25H26ClFN2O3/c1-15(2)32-24-9-5-17(12-22(24)27)21(20-8-7-19(26)11-16(20)3)13-23(28-31)18-6-10-25(30)29(4)14-18/h5-12,14-15,21,31H,13H2,1-4H3/b28-23- |
| InChIKey | PXABLVGIQUHWGM-NFFVHWSESA-N |
| XLogP | 5.67 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.95 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|