C29H24Cl2N2O4 — CID 58043180
4-[4-[(1S,3E)-1-(2,4-dichlorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]phenyl]-3-methylbenzoic acid (PubChem CID 58043180) has the molecular formula C29H24Cl2N2O4 and a molecular weight of 535.43 g/mol. Its IUPAC name is 4-[4-[(1S,3E)-1-(2,4-dichlorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]phenyl]-3-methylbenzoic acid.
| Compound Name | 4-[4-[(1S,3E)-1-(2,4-dichlorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]phenyl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 58043180 |
| Molecular Formula | C29H24Cl2N2O4 |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | 4-[4-[(1S,3E)-1-(2,4-dichlorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]phenyl]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1-c1ccc([C@H](C/C(=N\O)c2ccc(=O)n(C)c2)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C29H24Cl2N2O4/c1-17-13-20(29(35)36)7-10-23(17)18-3-5-19(6-4-18)25(24-11-9-22(30)14-26(24)31)15-27(32-37)21-8-12-28(34)33(2)16-21/h3-14,16,25,37H,15H2,1-2H3,(H,35,36)/b32-27+/t25-/m0/s1 |
| InChIKey | BTIIRYSFSBXPKV-PVLKXOFFSA-N |
| XLogP | 6.77 |
| TPSA | 91.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|